ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
| Produkt-Name |
Methyl 3-methoxy-2-nitrobenzoate |
| Englischer Name |
Methyl 3-methoxy-2-nitrobenzoate; 3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
| Molekulare Formel |
C9H9NO5 |
| Molecular Weight |
211.1715 |
| InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
| CAS Registry Number |
5307-17-5 |
| Molecular Structure |
|
| Dichte |
1.294g/cm3 |
| Siedepunkt |
325.4°C at 760 mmHg |
| Brechungsindex |
1.54 |
| Flammpunkt |
151.5°C |
| Dampfdruck |
0.00023mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|