504-20-1 phorone
| Naam product |
phorone |
| Engelse naam |
phorone; 2,6-Dimethyl-2,5-heptadien-4-one; Diisopropyllideneacetone; 2,6-dimethylhepta-2,5-dien-4-one |
| MF |
C9H14O |
| Molecuulgewicht |
138.2069 |
| InChI |
InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
| CAS-nummer |
504-20-1 |
| EINECS |
207-986-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.858g/cm3 |
| Smeltpunt |
23-26℃ |
| Kookpunt |
198.5°C at 760 mmHg |
| Brekingsindex |
1.453 |
| Vlampunt |
79.4°C |
| Dampdruk |
0.358mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|