504-20-1 phorone
| Produkt-Name |
phorone |
| Englischer Name |
phorone; 2,6-Dimethyl-2,5-heptadien-4-one; Diisopropyllideneacetone; 2,6-dimethylhepta-2,5-dien-4-one |
| Molekulare Formel |
C9H14O |
| Molecular Weight |
138.2069 |
| InChI |
InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
| CAS Registry Number |
504-20-1 |
| EINECS |
207-986-3 |
| Molecular Structure |
|
| Dichte |
0.858g/cm3 |
| Schmelzpunkt |
23-26℃ |
| Siedepunkt |
198.5°C at 760 mmHg |
| Brechungsindex |
1.453 |
| Flammpunkt |
79.4°C |
| Dampfdruck |
0.358mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|