ChemNet > CAS > 4906-25-6 Methyl 4-n-butoxybenzoate
4906-25-6 Methyl 4-n-butoxybenzoate
| Naam product |
Methyl 4-n-butoxybenzoate |
| Engelse naam |
Methyl 4-n-butoxybenzoate; 4-n-Butoxybenzoic acid methyl ester; methyl 2-butoxybenzoate; methyl 4-butoxybenzoate |
| MF |
C12H16O3 |
| Molecuulgewicht |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-3-4-9-15-11-7-5-10(6-8-11)12(13)14-2/h5-8H,3-4,9H2,1-2H3 |
| CAS-nummer |
4906-25-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.036g/cm3 |
| Kookpunt |
299.9°C at 760 mmHg |
| Brekingsindex |
1.495 |
| Vlampunt |
121.8°C |
| Dampdruk |
0.00116mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|