ChemNet > CAS > 4906-25-6 Methyl 4-n-butoxybenzoate
4906-25-6 Methyl 4-n-butoxybenzoate
| Produkt-Name |
Methyl 4-n-butoxybenzoate |
| Englischer Name |
Methyl 4-n-butoxybenzoate; 4-n-Butoxybenzoic acid methyl ester; methyl 2-butoxybenzoate; methyl 4-butoxybenzoate |
| Molekulare Formel |
C12H16O3 |
| Molecular Weight |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-3-4-9-15-11-7-5-10(6-8-11)12(13)14-2/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number |
4906-25-6 |
| Molecular Structure |
|
| Dichte |
1.036g/cm3 |
| Siedepunkt |
299.9°C at 760 mmHg |
| Brechungsindex |
1.495 |
| Flammpunkt |
121.8°C |
| Dampfdruck |
0.00116mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|