ChemNet > CAS > 446-24-2 2-Fluorobenzoic hydrazide
446-24-2 2-Fluorobenzoic hydrazide
| Naam product |
2-Fluorobenzoic hydrazide |
| Engelse naam |
2-Fluorobenzoic hydrazide; 2-Fluorobenzhydrazide; 2-fluorobenzohydrazide |
| MF |
C7H7FN2O |
| Molecuulgewicht |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| CAS-nummer |
446-24-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.272g/cm3 |
| Smeltpunt |
70-74℃ |
| Kookpunt |
309.1°C at 760 mmHg |
| Brekingsindex |
1.552 |
| Vlampunt |
140.7°C |
| Dampdruk |
0.000282mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|