ChemNet > CAS > 446-24-2 2-Fluorobenzoic hydrazide
446-24-2 2-Fluorobenzoic hydrazide
| Produkt-Name |
2-Fluorobenzoic hydrazide |
| Englischer Name |
2-Fluorobenzoic hydrazide; 2-Fluorobenzhydrazide; 2-fluorobenzohydrazide |
| Molekulare Formel |
C7H7FN2O |
| Molecular Weight |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| CAS Registry Number |
446-24-2 |
| Molecular Structure |
|
| Dichte |
1.272g/cm3 |
| Schmelzpunkt |
70-74℃ |
| Siedepunkt |
309.1°C at 760 mmHg |
| Brechungsindex |
1.552 |
| Flammpunkt |
140.7°C |
| Dampfdruck |
0.000282mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|