ChemNet > CAS > 395-81-3 5-fluoro-2-nitrobenzaldehyde
395-81-3 5-fluoro-2-nitrobenzaldehyde
| Naam product |
5-fluoro-2-nitrobenzaldehyde |
| Engelse naam |
5-fluoro-2-nitrobenzaldehyde; 2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
| MF |
C8H7FO3 |
| Molecuulgewicht |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS-nummer |
395-81-3 |
| EINECS |
206-903-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.307g/cm3 |
| Smeltpunt |
92-94℃ |
| Kookpunt |
266.9°C at 760 mmHg |
| Brekingsindex |
1.524 |
| Vlampunt |
115.2°C |
| Dampdruk |
0.00419mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|