ChemNet > CAS > 395-81-3 5-fluoro-2-nitrobenzaldehyde
395-81-3 5-fluoro-2-nitrobenzaldehyde
| Nama produk |
5-fluoro-2-nitrobenzaldehyde |
| Nama Inggeris |
5-fluoro-2-nitrobenzaldehyde; 2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
| MF |
C8H7FO3 |
| Berat Molekul |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS NO |
395-81-3 |
| EINECS |
206-903-8 |
| Struktur Molekul |
|
| Kepadatan |
1.307g/cm3 |
| Titik lebur |
92-94℃ |
| Titik didih |
266.9°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
115.2°C |
| Tekanan wap |
0.00419mmHg at 25°C |
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|