ChemNet > CAS > 329-79-3 4-Fluoroacetophenone oxime
329-79-3 4-Fluoroacetophenone oxime
| Naam product |
4-Fluoroacetophenone oxime |
| Engelse naam |
4-Fluoroacetophenone oxime; Acetophenone, 4'-fluoro-, oxime; 4'-Fluoroacetophenone oxime; BRN 2086063; NSC 154663; Ethanone, 1-(4-fluorophenyl)-, oxime (9CI); 1-(4-fluorophenyl)-N-hydroxyethanimine; (1E)-1-(4-fluorophenyl)ethanone oxime; (1Z)-1-(4-fluorophenyl)ethanone oxime |
| MF |
C8H8FNO |
| Molecuulgewicht |
153.1536 |
| InChI |
InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
| CAS-nummer |
329-79-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.12g/cm3 |
| Smeltpunt |
72℃ |
| Kookpunt |
239.8°C at 760 mmHg |
| Brekingsindex |
1.503 |
| Vlampunt |
98.8°C |
| Dampdruk |
0.0214mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|