ChemNet > CAS > 329-79-3 4-Fluoroacetophenone oxime
329-79-3 4-Fluoroacetophenone oxime
| product Name |
4-Fluoroacetophenone oxime |
| CAS No |
329-79-3 |
| Synonyms |
Acetophenone, 4'-fluoro-, oxime; 4'-Fluoroacetophenone oxime; BRN 2086063; NSC 154663; Ethanone, 1-(4-fluorophenyl)-, oxime (9CI); 1-(4-fluorophenyl)-N-hydroxyethanimine; (1E)-1-(4-fluorophenyl)ethanone oxime; (1Z)-1-(4-fluorophenyl)ethanone oxime |
| Molecular Formula |
C8H8FNO |
| Molecular Weight |
153.1536 |
| InChI |
InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
72℃ |
| Boiling point |
239.8°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
98.8°C |
| Vapour Pressur |
0.0214mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|