141-76-4 3-Iodopropionic acid
| Naam product |
3-Iodopropionic acid |
| Engelse naam |
3-Iodopropionic acid; Iodopropionicacid; 3-iodopropanoic acid; 3-iodopropanoate |
| MF |
C3H4IO2 |
| Molecuulgewicht |
198.9677 |
| InChI |
InChI=1/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| CAS-nummer |
141-76-4 |
| EINECS |
205-499-0 |
| Moleculaire Structuur |
|
| Smeltpunt |
80-85℃ |
| Kookpunt |
259.7°C at 760 mmHg |
| Vlampunt |
110.9°C |
| Dampdruk |
0.00383mmHg at 25°C |
| Gevaarsymbolen |
C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|