141-76-4 3-Iodopropionic acid
| Produkt-Name |
3-Iodopropionic acid |
| Englischer Name |
3-Iodopropionic acid; Iodopropionicacid; 3-iodopropanoic acid; 3-iodopropanoate |
| Molekulare Formel |
C3H4IO2 |
| Molecular Weight |
198.9677 |
| InChI |
InChI=1/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| CAS Registry Number |
141-76-4 |
| EINECS |
205-499-0 |
| Molecular Structure |
|
| Schmelzpunkt |
80-85℃ |
| Siedepunkt |
259.7°C at 760 mmHg |
| Flammpunkt |
110.9°C |
| Dampfdruck |
0.00383mmHg at 25°C |
| Gefahrensymbole |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|