ChemNet > CAS > 1083-30-3 beta-Phenylpropiophenone
1083-30-3 beta-Phenylpropiophenone
| Naam product |
beta-Phenylpropiophenone |
| Engelse naam |
beta-Phenylpropiophenone; 1,3-Diphenyl-1-propanone; 1,3-diphenylpropan-1-one |
| MF |
C15H14O |
| Molecuulgewicht |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| CAS-nummer |
1083-30-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.061g/cm3 |
| Kookpunt |
352.7°C at 760 mmHg |
| Brekingsindex |
1.574 |
| Vlampunt |
152.9°C |
| Dampdruk |
3.78E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|