ChemNet > CAS > 1083-30-3 beta-Phenylpropiophenone
1083-30-3 beta-Phenylpropiophenone
| Produkt-Name |
beta-Phenylpropiophenone |
| Englischer Name |
beta-Phenylpropiophenone; 1,3-Diphenyl-1-propanone; 1,3-diphenylpropan-1-one |
| Molekulare Formel |
C15H14O |
| Molecular Weight |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| CAS Registry Number |
1083-30-3 |
| Molecular Structure |
|
| Dichte |
1.061g/cm3 |
| Siedepunkt |
352.7°C at 760 mmHg |
| Brechungsindex |
1.574 |
| Flammpunkt |
152.9°C |
| Dampfdruck |
3.78E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|