ChemNet > CAS > 614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
| Nama produk |
4-(2-Methylphenyl)-3-thiosemicarbazide |
| Nama Inggeris |
4-(2-Methylphenyl)-3-thiosemicarbazide; 4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
| MF |
C8H11N3S |
| Berat Molekul |
181.258 |
| InChI |
InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
| CAS NO |
614-10-8 |
| Struktur Molekul |
|
| Kepadatan |
1.27g/cm3 |
| Titik didih |
295.9°C at 760 mmHg |
| Indeks bias |
1.699 |
| Titik nyala |
132.8°C |
| Tekanan wap |
0.00148mmHg at 25°C |
| Kod Risiko |
R25:Toxic if swallowed.;
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|