ChemNet > CAS > 614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
| název vyrobku |
4-(2-Methylphenyl)-3-thiosemicarbazide |
| Anglicky název |
4-(2-Methylphenyl)-3-thiosemicarbazide; 4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
| Molekulární vzorec |
C8H11N3S |
| Molekulová hmotnost |
181.258 |
| InChI |
InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
| Registra?ní ?íslo CAS |
614-10-8 |
| Molekulární struktura |
|
| Hustota |
1.27g/cm3 |
| Bod varu |
295.9°C at 760 mmHg |
| Index lomu |
1.699 |
| Bod vzplanutí |
132.8°C |
| Tlak par |
0.00148mmHg at 25°C |
| Riziko Codes |
R25:Toxic if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|