ChemNet > CAS > 5182-44-5 3-Chlorophenethylalcohol
5182-44-5 3-Chlorophenethylalcohol
| Nama produk |
3-Chlorophenethylalcohol |
| Nama Inggeris |
3-Chlorophenethylalcohol; 3-Chlorophenethyl alcohol; 2-(3-Chlorophenyl)ethanol |
| MF |
C8H9ClO |
| Berat Molekul |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| CAS NO |
5182-44-5 |
| EINECS |
225-964-1 |
| Struktur Molekul |
|
| Kepadatan |
1.189g/cm3 |
| Titik didih |
257.2°C at 760 mmHg |
| Indeks bias |
1.554 |
| Titik nyala |
101.1°C |
| Tekanan wap |
0.00756mmHg at 25°C |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|