ChemNet > CAS > 5182-44-5 3-Chlorophenethylalcohol
5182-44-5 3-Chlorophenethylalcohol
| Nome del prodotto |
3-Chlorophenethylalcohol |
| Nome inglese |
3-Chlorophenethylalcohol; 3-Chlorophenethyl alcohol; 2-(3-Chlorophenyl)ethanol |
| Formula molecolare |
C8H9ClO |
| Peso Molecolare |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| Numero CAS |
5182-44-5 |
| EINECS |
225-964-1 |
| Struttura molecolare |
|
| Densità |
1.189g/cm3 |
| Punto di ebollizione |
257.2°C at 760 mmHg |
| Indice di rifrazione |
1.554 |
| Punto d'infiammabilità |
101.1°C |
| Pressione di vapore |
0.00756mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|