100-80-1 m-Vinyltoluene
| Nama produk |
m-Vinyltoluene |
| Nama Inggeris |
m-Vinyltoluene; 3-Methylstyrene; 3-Vinyltoluene |
| MF |
C9H10 |
| Berat Molekul |
118.17 |
| InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
| CAS NO |
100-80-1 |
| EINECS |
202-889-2 |
| Struktur Molekul |
|
| Kepadatan |
170 |
| Titik didih |
171℃ |
| Kod Risiko |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|