100-80-1 m-Vinyltoluene
| Nom |
m-Vinyltoluene |
| Nom anglais |
m-Vinyltoluene; 3-Methylstyrene; 3-Vinyltoluene |
| Formule moléculaire |
C9H10 |
| Poids Moléculaire |
118.17 |
| InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
| Numéro de registre CAS |
100-80-1 |
| EINECS |
202-889-2 |
| Structure moléculaire |
|
| Densité |
170 |
| Point d'ébullition |
171℃ |
| Codes des risques |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|