ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
| ???? |
Triethylamine hydrobromide |
| ?? ?? |
Triethylamine hydrobromide; triethylammonium bromide |
| ??? |
C6H15N.HBr |
| ??? |
182.10 |
| InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| cas?? |
636-70-4 |
| EC?? |
211-263-8 |
| ?? ?? |
|
| ?? ? |
246-248℃ |
| ??? ?? |
Xi:Irritant;
|
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|