ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
| ??? ????? |
Triethylamine hydrobromide |
| ??? ??????? |
Triethylamine hydrobromide; triethylammonium bromide |
| ????? ???????? |
C6H15N.HBr |
| ??? ??????? |
182.10 |
| InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| ????? ?????? |
636-70-4 |
| ????? ??????? ??????? |
211-263-8 |
| ?????? ??????? |
|
| ???? ??? |
246-248℃ |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|