623-37-0 3-Hexanol
| ???? |
3-Hexanol |
| ?? ?? |
3-Hexanol; 3-Hexyl alcohol; Ethyl propyl carbinol; FEMA No. 3351; NSC 60708; hexan-3-ol; (3S)-hexan-3-ol; (3R)-hexan-3-ol |
| ??? |
C6H14O |
| ??? |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| cas?? |
623-37-0 |
| EC?? |
210-790-0 |
| ?? ?? |
|
| ?? |
0.814g/cm3 |
| ??? |
135°C at 760 mmHg |
| ?? ?? |
1.413 |
| ??? |
41.7°C |
| ??? |
3.39mmHg at 25°C |
| ??? ?? |
Xn:Harmful;
|
| ??? ?? |
R10:Flammable.;
R22:Harmful if swallowed.;
|
| ?? ?? |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|