614-76-6 2'-Bromoacetanilide
| ???? |
2'-Bromoacetanilide |
| ?? ?? |
2'-Bromoacetanilide; 2-Bromoacetanilide; N-(2-bromophenyl)acetamide |
| ??? |
C8H8BrNO |
| ??? |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
| cas?? |
614-76-6 |
| ?? ?? |
|
| ?? |
1.543g/cm3 |
| ?? ? |
96.5-100.5℃ |
| ??? |
346.8°C at 760 mmHg |
| ?? ?? |
1.611 |
| ??? |
163.5°C |
| ??? |
5.62E-05mmHg at 25°C |
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|