614-76-6 2'-Bromoacetanilide
| Produkt-Name |
2'-Bromoacetanilide |
| Englischer Name |
2'-Bromoacetanilide; 2-Bromoacetanilide; N-(2-bromophenyl)acetamide |
| Molekulare Formel |
C8H8BrNO |
| Molecular Weight |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
| CAS Registry Number |
614-76-6 |
| Molecular Structure |
|
| Dichte |
1.543g/cm3 |
| Schmelzpunkt |
96.5-100.5℃ |
| Siedepunkt |
346.8°C at 760 mmHg |
| Brechungsindex |
1.611 |
| Flammpunkt |
163.5°C |
| Dampfdruck |
5.62E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|