491-78-1 Primuletin
| ???? |
Primuletin |
| ?? ?? |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| ??? |
C15H10O3 |
| ??? |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| cas?? |
491-78-1 |
| EC?? |
207-743-1 |
| ?? ?? |
|
| ?? |
1.34g/cm3 |
| ??? |
425°C at 760 mmHg |
| ?? ?? |
1.666 |
| ??? |
165.4°C |
| ??? |
7.97E-08mmHg at 25°C |
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|