491-78-1 Primuletin
| ??? ????? |
Primuletin |
| ??? ??????? |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| ????? ???????? |
C15H10O3 |
| ??? ??????? |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| ????? ?????? |
491-78-1 |
| ????? ??????? ??????? |
207-743-1 |
| ?????? ??????? |
|
| ????? |
1.34g/cm3 |
| ???? ????? |
425°C at 760 mmHg |
| ???? ???? |
1.666 |
| ???? ?????? |
165.4°C |
| ???? ???? |
7.97E-08mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|