87-05-8 7-Ethoxy-4-methylcoumarin
| Nome del prodotto |
7-Ethoxy-4-methylcoumarin |
| Nome inglese |
7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
| Formula molecolare |
C12H12O3 |
| Peso Molecolare |
204.2219 |
| InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
| Numero CAS |
87-05-8 |
| EINECS |
201-721-5 |
| Struttura molecolare |
|
| Densità |
1.163g/cm3 |
| Punto di fusione |
113-114℃ |
| Punto di ebollizione |
351.4°C at 760 mmHg |
| Indice di rifrazione |
1.548 |
| Punto d'infiammabilità |
146.2°C |
| Pressione di vapore |
4.12E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|