87-05-8 7-Ethoxy-4-methylcoumarin
| Produkt-Name |
7-Ethoxy-4-methylcoumarin |
| Englischer Name |
7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
| Molekulare Formel |
C12H12O3 |
| Molecular Weight |
204.2219 |
| InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
| CAS Registry Number |
87-05-8 |
| EINECS |
201-721-5 |
| Molecular Structure |
|
| Dichte |
1.163g/cm3 |
| Schmelzpunkt |
113-114℃ |
| Siedepunkt |
351.4°C at 760 mmHg |
| Brechungsindex |
1.548 |
| Flammpunkt |
146.2°C |
| Dampfdruck |
4.12E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|