818-23-5 8-Pentadecanone
| Nome del prodotto |
8-Pentadecanone |
| Nome inglese |
8-Pentadecanone; Di-n-heptyl ketone; pentadecane-8-one; pentadecan-8-one |
| Formula molecolare |
C15H30O |
| Peso Molecolare |
226.3981 |
| InChI |
InChI=1/C15H30O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| Numero CAS |
818-23-5 |
| EINECS |
212-450-7 |
| Struttura molecolare |
|
| Densità |
0.828g/cm3 |
| Punto di fusione |
40-44℃ |
| Punto di ebollizione |
292.6°C at 760 mmHg |
| Indice di rifrazione |
1.436 |
| Punto d'infiammabilità |
83.1°C |
| Pressione di vapore |
0.00182mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|