818-23-5 8-Pentadecanone
| Produkt-Name |
8-Pentadecanone |
| Englischer Name |
8-Pentadecanone; Di-n-heptyl ketone; pentadecane-8-one; pentadecan-8-one |
| Molekulare Formel |
C15H30O |
| Molecular Weight |
226.3981 |
| InChI |
InChI=1/C15H30O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| CAS Registry Number |
818-23-5 |
| EINECS |
212-450-7 |
| Molecular Structure |
|
| Dichte |
0.828g/cm3 |
| Schmelzpunkt |
40-44℃ |
| Siedepunkt |
292.6°C at 760 mmHg |
| Brechungsindex |
1.436 |
| Flammpunkt |
83.1°C |
| Dampfdruck |
0.00182mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|