ChemNet > CAS > 7260-11-9 Phenyl 3-hydroxy-2-naphthoate
7260-11-9 Phenyl 3-hydroxy-2-naphthoate
| Nome del prodotto |
Phenyl 3-hydroxy-2-naphthoate |
| Nome inglese |
Phenyl 3-hydroxy-2-naphthoate; 3-Hydroxy-2-naphthoic acid phenyl ester; phenyl 3-hydroxynaphthalene-2-carboxylate |
| Formula molecolare |
C17H12O3 |
| Peso Molecolare |
264.2754 |
| InChI |
InChI=1/C17H12O3/c18-16-11-13-7-5-4-6-12(13)10-15(16)17(19)20-14-8-2-1-3-9-14/h1-11,18H |
| Numero CAS |
7260-11-9 |
| EINECS |
230-681-1 |
| Struttura molecolare |
|
| Densità |
1.286g/cm3 |
| Punto di fusione |
128-133℃ |
| Punto di ebollizione |
423.2°C at 760 mmHg |
| Indice di rifrazione |
1.68 |
| Punto d'infiammabilità |
179.8°C |
| Pressione di vapore |
9.27E-08mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|