ChemNet > CAS > 7260-11-9 Phenyl 3-hydroxy-2-naphthoate
7260-11-9 Phenyl 3-hydroxy-2-naphthoate
| product Name |
Phenyl 3-hydroxy-2-naphthoate |
| CAS No |
7260-11-9 |
| Synonyms |
3-Hydroxy-2-naphthoic acid phenyl ester; phenyl 3-hydroxynaphthalene-2-carboxylate |
| Molecular Formula |
C17H12O3 |
| Molecular Weight |
264.2754 |
| InChI |
InChI=1/C17H12O3/c18-16-11-13-7-5-4-6-12(13)10-15(16)17(19)20-14-8-2-1-3-9-14/h1-11,18H |
| EINECS |
230-681-1 |
| Molecular Structure |
|
| Density |
1.286g/cm3 |
| Melting point |
128-133℃ |
| Boiling point |
423.2°C at 760 mmHg |
| Refractive index |
1.68 |
| Flash point |
179.8°C |
| Vapour Pressur |
9.27E-08mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|