611-79-0 3,3'-Diaminobenzophenone
| Nome del prodotto |
3,3'-Diaminobenzophenone |
| Nome inglese |
3,3'-Diaminobenzophenone; bis(3-aminophenyl)methanone |
| Formula molecolare |
C13H12N2O |
| Peso Molecolare |
212.2472 |
| InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| Numero CAS |
611-79-0 |
| EINECS |
210-281-3 |
| Struttura molecolare |
|
| Densità |
1.233g/cm3 |
| Punto di ebollizione |
469.4°C at 760 mmHg |
| Indice di rifrazione |
1.673 |
| Punto d'infiammabilità |
237.7°C |
| Pressione di vapore |
5.51E-09mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|