611-79-0 3,3'-Diaminobenzophenone
| product Name |
3,3'-Diaminobenzophenone |
| CAS No |
611-79-0 |
| Synonyms |
bis(3-aminophenyl)methanone |
| Molecular Formula |
C13H12N2O |
| Molecular Weight |
212.2472 |
| InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| EINECS |
210-281-3 |
| Molecular Structure |
|
| Density |
1.233g/cm3 |
| Boiling point |
469.4°C at 760 mmHg |
| Refractive index |
1.673 |
| Flash point |
237.7°C |
| Vapour Pressur |
5.51E-09mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
0086-519-83138042;83137042;83137041;0086-519-83139028(english);83131668(english) |
| Email |
info@sunlightchem.com |
| Address |
JiuliStreet, Benniu Town Changzhou, Jiangsu Province, China. |
| Telephone |
+86-21-62113509 62113270 |
| Email |
Sales@sjpharm.com |
| Address |
7966 Tingfeng Road, Jinshan District, Shanghai |
| Packing |
paper bucket, 20kg/package. |
| Contact |
Mr Yang |
| Telephone |
+86-13509187513 |
| Email |
info@dashengpharm.com |
| Address |
9F of Jiezuo Square, No.2 South Fenghui Rd., Hi-tech Industrial Developing Zone, Xi'an, China. |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |