ChemNet > CAS > 5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
| Nome del prodotto |
Methyl 3-methoxy-4-nitrobenzoate |
| Nome inglese |
Methyl 3-methoxy-4-nitrobenzoate; 3-Methoxy-4-nitrobenzoic acid methyl ester; acid methyl ester |
| Formula molecolare |
C9H9NO5 |
| Peso Molecolare |
211.1715 |
| InChI |
InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
| Numero CAS |
5081-37-8 |
| Struttura molecolare |
|
| Densità |
1.294g/cm3 |
| Punto di fusione |
86-88℃ |
| Punto di ebollizione |
350.7°C at 760 mmHg |
| Indice di rifrazione |
1.54 |
| Punto d'infiammabilità |
168.3°C |
| Pressione di vapore |
4.3E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|