ChemNet > CAS > 5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
| product Name |
Methyl 3-methoxy-4-nitrobenzoate |
| CAS No |
5081-37-8 |
| Synonyms |
3-Methoxy-4-nitrobenzoic acid methyl ester; acid methyl ester |
| Molecular Formula |
C9H9NO5 |
| Molecular Weight |
211.1715 |
| InChI |
InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.294g/cm3 |
| Melting point |
86-88℃ |
| Boiling point |
350.7°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
168.3°C |
| Vapour Pressur |
4.3E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |