4652-27-1 4-Methoxy-3-buten-2-one
| Nome del prodotto |
4-Methoxy-3-buten-2-one |
| Nome inglese |
4-Methoxy-3-buten-2-one;4-Methoxybut-3-en-2-one; (3E)-4-methoxybut-3-en-2-one; (3Z)-4-methoxybut-3-en-2-one |
| Formula molecolare |
C5H8O2 |
| Peso Molecolare |
100.1158 |
| InChI |
InChI=1/C5H8O2/c1-5(6)3-4-7-2/h3-4H,1-2H3/b4-3- |
| Numero CAS |
4652-27-1 |
| EINECS |
225-087-4 |
| Struttura molecolare |
|
| Densità |
0.925g/cm3 |
| Punto di ebollizione |
200°C at 760 mmHg |
| Indice di rifrazione |
1.414 |
| Punto d'infiammabilità |
63.3°C |
| Pressione di vapore |
0.332mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|