4652-27-1 4-Methoxy-3-buten-2-one
| product Name |
4-Methoxy-3-buten-2-one |
| CAS No |
4652-27-1 |
| Synonyms |
4-Methoxybut-3-en-2-one; (3E)-4-methoxybut-3-en-2-one; (3Z)-4-methoxybut-3-en-2-one |
| Molecular Formula |
C5H8O2 |
| Molecular Weight |
100.1158 |
| InChI |
InChI=1/C5H8O2/c1-5(6)3-4-7-2/h3-4H,1-2H3/b4-3- |
| EINECS |
225-087-4 |
| Molecular Structure |
|
| Density |
0.925g/cm3 |
| Boiling point |
200°C at 760 mmHg |
| Refractive index |
1.414 |
| Flash point |
63.3°C |
| Vapour Pressur |
0.332mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |