4433-30-1 Undecanophenone
| Nome del prodotto |
Undecanophenone |
| Nome inglese |
Undecanophenone; n-Decyl phenyl ketone; 1-phenylundecan-2-one |
| Formula molecolare |
C17H26O |
| Peso Molecolare |
246.3877 |
| InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| Numero CAS |
4433-30-1 |
| EINECS |
224-633-9 |
| Struttura molecolare |
|
| Densità |
0.92g/cm3 |
| Punto di fusione |
28-30℃ |
| Punto di ebollizione |
342.846°C at 760 mmHg |
| Indice di rifrazione |
1.49 |
| Punto d'infiammabilità |
114.968°C |
| Pressione di vapore |
0mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|