4433-30-1 Undecanophenone
| Produkt-Name |
Undecanophenone |
| Englischer Name |
Undecanophenone; n-Decyl phenyl ketone; 1-phenylundecan-2-one |
| Molekulare Formel |
C17H26O |
| Molecular Weight |
246.3877 |
| InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| CAS Registry Number |
4433-30-1 |
| EINECS |
224-633-9 |
| Molecular Structure |
|
| Dichte |
0.92g/cm3 |
| Schmelzpunkt |
28-30℃ |
| Siedepunkt |
342.846°C at 760 mmHg |
| Brechungsindex |
1.49 |
| Flammpunkt |
114.968°C |
| Dampfdruck |
0mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|