ChemNet > CAS > 4376-18-5 Methyl hydrogen phthalate
4376-18-5 Methyl hydrogen phthalate
| Nome del prodotto |
Methyl hydrogen phthalate |
| Nome inglese |
Methyl hydrogen phthalate; Monomethyl phthalate~Phthalic acid monomethyl ester; mono-Methyl phthalate; Phthalic acid monomethyl ester; Benzene-1,2-dicarboxylic acid monomethyl ester~Monomethyl phthalate~Phthalic acid monomethyl ester; 2-(methoxycarbonyl)benzoic acid; 2-(methoxycarbonyl)benzoate |
| Formula molecolare |
C9H7O4 |
| Peso Molecolare |
179.15 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11)/p-1 |
| Numero CAS |
4376-18-5 |
| EINECS |
224-476-6 |
| Struttura molecolare |
|
| Punto di fusione |
81-84℃ |
| Punto di ebollizione |
328.9°C at 760 mmHg |
| Punto d'infiammabilità |
134.7°C |
| Pressione di vapore |
7.39E-05mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|