ChemNet > CAS > 4376-18-5 Methyl hydrogen phthalate
4376-18-5 Methyl hydrogen phthalate
| product Name |
Methyl hydrogen phthalate |
| CAS No |
4376-18-5 |
| Synonyms |
Monomethyl phthalate~Phthalic acid monomethyl ester; mono-Methyl phthalate; Phthalic acid monomethyl ester; Benzene-1,2-dicarboxylic acid monomethyl ester~Monomethyl phthalate~Phthalic acid monomethyl ester; 2-(methoxycarbonyl)benzoic acid; 2-(methoxycarbonyl)benzoate |
| Molecular Formula |
C9H7O4 |
| Molecular Weight |
179.15 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11)/p-1 |
| EINECS |
224-476-6 |
| Molecular Structure |
|
| Melting point |
81-84℃ |
| Boiling point |
328.9°C at 760 mmHg |
| Flash point |
134.7°C |
| Vapour Pressur |
7.39E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |