ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
| Nome del prodotto |
3,5-Dichlorophenylhydrazine |
| Nome inglese |
3,5-Dichlorophenylhydrazine; |
| Formula molecolare |
C6H6Cl2N2 |
| Peso Molecolare |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| Numero CAS |
39943-56-1 |
| Struttura molecolare |
|
| Densità |
1.475g/cm3 |
| Punto di ebollizione |
286.1°C at 760 mmHg |
| Indice di rifrazione |
1.665 |
| Punto d'infiammabilità |
126.8°C |
| Pressione di vapore |
0.0027mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|