ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
| product Name |
3,5-Dichlorophenylhydrazine |
| CAS No |
39943-56-1 |
| Molecular Formula |
C6H6Cl2N2 |
| Molecular Weight |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| Molecular Structure |
|
| Density |
1.475g/cm3 |
| Boiling point |
286.1°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
126.8°C |
| Vapour Pressur |
0.0027mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|