ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
| Nome del prodotto |
Dichlorobenzylalcohol; 98% |
| Nome inglese |
Dichlorobenzylalcohol; 98%; 2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
| Formula molecolare |
C7H6Cl2O |
| Peso Molecolare |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
| Numero CAS |
38594-42-2 |
| Struttura molecolare |
|
| Densità |
1.392g/cm3 |
| Punto di fusione |
85-88℃ |
| Punto di ebollizione |
271.2°C at 760 mmHg |
| Indice di rifrazione |
1.582 |
| Punto d'infiammabilità |
115.8°C |
| Pressione di vapore |
0.00321mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|