ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
| Nama produk |
Dichlorobenzylalcohol; 98% |
| Nama bahasa Inggris |
Dichlorobenzylalcohol; 98%; 2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
| MF |
C7H6Cl2O |
| Berat Molekul |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
| CAS NO |
38594-42-2 |
| Struktur Molekul |
|
| Kepadatan |
1.392g/cm3 |
| Titik lebur |
85-88℃ |
| Titik didih |
271.2°C at 760 mmHg |
| Indeks bias |
1.582 |
| Titik nyala |
115.8°C |
| Tekanan uap |
0.00321mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|