ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
| Nome del prodotto |
4-Fluoro-1-iodo-2-nitrobenzene |
| Nome inglese |
4-Fluoro-1-iodo-2-nitrobenzene; 2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene; 1-Fluoro-4-iodo-3-nitrobenzene |
| Formula molecolare |
C6H5FN2O2 |
| Peso Molecolare |
156.1145 |
| InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Numero CAS |
364-77-2 |
| EINECS |
206-666-0 |
| Struttura molecolare |
|
| Densità |
1.448g/cm3 |
| Punto di ebollizione |
295.1°C at 760 mmHg |
| Indice di rifrazione |
1.603 |
| Punto d'infiammabilità |
89.4°C |
| Pressione di vapore |
0.00155mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|