ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
| Ονομασ?α του προ??ντο? |
4-Fluoro-1-iodo-2-nitrobenzene |
| Αγγλικ? ?νομα |
4-Fluoro-1-iodo-2-nitrobenzene; 2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene; 1-Fluoro-4-iodo-3-nitrobenzene |
| MF |
C6H5FN2O2 |
| Μοριακ? β?ρο? |
156.1145 |
| InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| CAS ΟΧΙ |
364-77-2 |
| EINECS |
206-666-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.448g/cm3 |
| Σημε?ο βρασμο? |
295.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.603 |
| Σημε?ο αν?φλεξη? |
89.4°C |
| Π?εση ατμ?ν |
0.00155mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|